C15H24N2O4S — CID 119989981
methyl 2-[(2-amino-2-ethylbutyl)sulfamoylmethyl]benzoate (PubChem CID 119989981) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is methyl 2-[(2-amino-2-ethylbutyl)sulfamoylmethyl]benzoate.
| Compound Name | methyl 2-[(2-amino-2-ethylbutyl)sulfamoylmethyl]benzoate |
|---|---|
| PubChem CID | 119989981 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | methyl 2-[(2-amino-2-ethylbutyl)sulfamoylmethyl]benzoate |
| SMILES | CCC(N)(CC)CNS(=O)(=O)Cc1ccccc1C(=O)OC |
| InChI | InChI=1S/C15H24N2O4S/c1-4-15(16,5-2)11-17-22(19,20)10-12-8-6-7-9-13(12)14(18)21-3/h6-9,17H,4-5,10-11,16H2,1-3H3 |
| InChIKey | JKYVGXWQSLVAEJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |