C28H32N4O5 — CID 73139791
[3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-tert-butylphenyl)carbamate (PubChem CID 73139791) has the molecular formula C28H32N4O5 and a molecular weight of 504.59 g/mol. Its IUPAC name is [3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-tert-butylphenyl)carbamate.
| Compound Name | [3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-tert-butylphenyl)carbamate |
|---|---|
| PubChem CID | 73139791 |
| Molecular Formula | C28H32N4O5 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | [3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-tert-butylphenyl)carbamate |
| SMILES | COc1ccc(-c2ccnc(NC3COC4C(OC(=O)Nc5ccc(C(C)(C)C)cc5)COC34)n2)cc1 |
| InChI | InChI=1S/C28H32N4O5/c1-28(2,3)18-7-9-19(10-8-18)30-27(33)37-23-16-36-24-22(15-35-25(23)24)32-26-29-14-13-21(31-26)17-5-11-20(34-4)12-6-17/h5-14,22-25H,15-16H2,1-4H3,(H,30,33)(H,29,31,32) |
| InChIKey | RSRDJQWQCXLMHD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |