C25H26N4O4 — CID 162980082
N-[(3S,3aS,6R,6aR)-3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-4-methylbenzamide (PubChem CID 162980082) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is N-[(3S,3aS,6R,6aR)-3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-4-methylbenzamide.
| Compound Name | N-[(3S,3aS,6R,6aR)-3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 162980082 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | N-[(3S,3aS,6R,6aR)-3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-4-methylbenzamide |
| SMILES | COc1ccc(-c2ccnc(N[C@H]3CO[C@H]4[C@H]3OC[C@H]4NC(=O)c3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C25H26N4O4/c1-15-3-5-17(6-4-15)24(30)27-20-13-32-23-21(14-33-22(20)23)29-25-26-12-11-19(28-25)16-7-9-18(31-2)10-8-16/h3-12,20-23H,13-14H2,1-2H3,(H,27,30)(H,26,28,29)/t20-,21+,22-,23+/m1/s1 |
| InChIKey | YZRRIUSJVIBTLS-ACESQOTJSA-N |
| XLogP | 2.84 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |