C26H30N6O3S — CID 11911704
1-[(3S,3aR,6S,6aR)-3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-[4-(dimethylamino)phenyl]thiourea (PubChem CID 11911704) has the molecular formula C26H30N6O3S and a molecular weight of 506.63 g/mol. Its IUPAC name is 1-[(3S,3aR,6S,6aR)-3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-[4-(dimethylamino)phenyl]thiourea.
| Compound Name | 1-[(3S,3aR,6S,6aR)-3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-[4-(dimethylamino)phenyl]thiourea |
|---|---|
| PubChem CID | 11911704 |
| Molecular Formula | C26H30N6O3S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 1-[(3S,3aR,6S,6aR)-3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-[4-(dimethylamino)phenyl]thiourea |
| SMILES | COc1ccc(-c2ccnc(N[C@H]3CO[C@H]4[C@@H]3OC[C@@H]4NC(=S)Nc3ccc(N(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C26H30N6O3S/c1-32(2)18-8-6-17(7-9-18)28-26(36)31-22-15-35-23-21(14-34-24(22)23)30-25-27-13-12-20(29-25)16-4-10-19(33-3)11-5-16/h4-13,21-24H,14-15H2,1-3H3,(H,27,29,30)(H2,28,31,36)/t21-,22-,23+,24+/m0/s1 |
| InChIKey | SYRPGQDLSUYKLI-CJRSTVEYSA-N |
| XLogP | 3.15 |
| TPSA | 92.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|