C27H30N6O4 — CID 73147304
1-(4-acetylphenyl)-3-[3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]urea (PubChem CID 73147304) has the molecular formula C27H30N6O4 and a molecular weight of 502.58 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-3-[3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]urea.
| Compound Name | 1-(4-acetylphenyl)-3-[3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]urea |
|---|---|
| PubChem CID | 73147304 |
| Molecular Formula | C27H30N6O4 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | 1-(4-acetylphenyl)-3-[3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]urea |
| SMILES | CC(=O)c1ccc(NC(=O)NC2COC3C(Nc4nccc(-c5ccc(N(C)C)cc5)n4)COC23)cc1 |
| InChI | InChI=1S/C27H30N6O4/c1-16(34)17-4-8-19(9-5-17)29-27(35)32-23-15-37-24-22(14-36-25(23)24)31-26-28-13-12-21(30-26)18-6-10-20(11-7-18)33(2)3/h4-13,22-25H,14-15H2,1-3H3,(H,28,30,31)(H2,29,32,35) |
| InChIKey | ZFWSHBVSULJHCN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |