C26H27F3N6O3 — CID 11939952
1-[(3S,3aR,6S,6aR)-3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 11939952) has the molecular formula C26H27F3N6O3 and a molecular weight of 528.54 g/mol. Its IUPAC name is 1-[(3S,3aR,6S,6aR)-3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(3S,3aR,6S,6aR)-3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 11939952 |
| Molecular Formula | C26H27F3N6O3 |
| Molecular Weight | 528.54 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 1-[(3S,3aR,6S,6aR)-3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CN(C)c1ccc(-c2ccnc(N[C@H]3CO[C@H]4[C@@H]3OC[C@@H]4NC(=O)Nc3cccc(C(F)(F)F)c3)n2)cc1 |
| InChI | InChI=1S/C26H27F3N6O3/c1-35(2)18-8-6-15(7-9-18)19-10-11-30-24(32-19)33-20-13-37-23-21(14-38-22(20)23)34-25(36)31-17-5-3-4-16(12-17)26(27,28)29/h3-12,20-23H,13-14H2,1-2H3,(H,30,32,33)(H2,31,34,36)/t20-,21-,22+,23+/m0/s1 |
| InChIKey | PJNRWPDBAJGPTH-MYDTUXCISA-N |
| XLogP | 4.00 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |