C24H21F4N5O3 — CID 162818996
1-[(3R,3aR,6S,6aS)-3-[[4-(3-fluorophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 162818996) has the molecular formula C24H21F4N5O3 and a molecular weight of 503.46 g/mol. Its IUPAC name is 1-[(3R,3aR,6S,6aS)-3-[[4-(3-fluorophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(3R,3aR,6S,6aS)-3-[[4-(3-fluorophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 162818996 |
| Molecular Formula | C24H21F4N5O3 |
| Molecular Weight | 503.46 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 1-[(3R,3aR,6S,6aS)-3-[[4-(3-fluorophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)N[C@H]1CO[C@H]2[C@H]1OC[C@H]2Nc1nccc(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C24H21F4N5O3/c25-15-5-1-3-13(9-15)17-7-8-29-22(31-17)32-18-11-35-21-19(12-36-20(18)21)33-23(34)30-16-6-2-4-14(10-16)24(26,27)28/h1-10,18-21H,11-12H2,(H,29,31,32)(H2,30,33,34)/t18-,19+,20-,21+/m1/s1 |
| InChIKey | UDVMNGUSVYVEEH-MHTWAQMVSA-N |
| XLogP | 4.07 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |