C21H25FN4O3 — CID 73140058
N-[3-[[4-(3-fluorophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2,2-dimethylpropanamide (PubChem CID 73140058) has the molecular formula C21H25FN4O3 and a molecular weight of 400.45 g/mol. Its IUPAC name is N-[3-[[4-(3-fluorophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-[[4-(3-fluorophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 73140058 |
| Molecular Formula | C21H25FN4O3 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N-[3-[[4-(3-fluorophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NC1COC2C(Nc3nccc(-c4cccc(F)c4)n3)COC12 |
| InChI | InChI=1S/C21H25FN4O3/c1-21(2,3)19(27)24-15-10-28-18-16(11-29-17(15)18)26-20-23-8-7-14(25-20)12-5-4-6-13(22)9-12/h4-9,15-18H,10-11H2,1-3H3,(H,24,27)(H,23,25,26) |
| InChIKey | QKVRVMHLNRJLIR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |