C19H20FN3O5 — CID 73139577
methyl 2-[[3-[[4-(3-fluorophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate (PubChem CID 73139577) has the molecular formula C19H20FN3O5 and a molecular weight of 389.38 g/mol. Its IUPAC name is methyl 2-[[3-[[4-(3-fluorophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate.
| Compound Name | methyl 2-[[3-[[4-(3-fluorophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 73139577 |
| Molecular Formula | C19H20FN3O5 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | methyl 2-[[3-[[4-(3-fluorophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate |
| SMILES | COC(=O)COC1COC2C(Nc3nccc(-c4cccc(F)c4)n3)COC12 |
| InChI | InChI=1S/C19H20FN3O5/c1-25-16(24)10-26-15-9-28-17-14(8-27-18(15)17)23-19-21-6-5-13(22-19)11-3-2-4-12(20)7-11/h2-7,14-15,17-18H,8-10H2,1H3,(H,21,22,23) |
| InChIKey | FBQXDEYBXXSUSM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |