C20H20N4O5 — CID 162812487
methyl 2-[[(3S,3aS,6S,6aS)-3-[[4-(3-cyanophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate (PubChem CID 162812487) has the molecular formula C20H20N4O5 and a molecular weight of 396.40 g/mol. Its IUPAC name is methyl 2-[[(3S,3aS,6S,6aS)-3-[[4-(3-cyanophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate.
| Compound Name | methyl 2-[[(3S,3aS,6S,6aS)-3-[[4-(3-cyanophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 162812487 |
| Molecular Formula | C20H20N4O5 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | methyl 2-[[(3S,3aS,6S,6aS)-3-[[4-(3-cyanophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate |
| SMILES | COC(=O)CO[C@H]1CO[C@@H]2[C@@H]1OC[C@@H]2Nc1nccc(-c2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C20H20N4O5/c1-26-17(25)11-27-16-10-29-18-15(9-28-19(16)18)24-20-22-6-5-14(23-20)13-4-2-3-12(7-13)8-21/h2-7,15-16,18-19H,9-11H2,1H3,(H,22,23,24)/t15-,16-,18-,19+/m0/s1 |
| InChIKey | HAUJWTZLHLEZPL-PBWTXFEYSA-N |
| XLogP | 1.15 |
| TPSA | 115.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |