C25H26N4O4 — CID 73140015
2-methoxy-N-[3-[[4-(4-phenylphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]acetamide (PubChem CID 73140015) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is 2-methoxy-N-[3-[[4-(4-phenylphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]acetamide.
| Compound Name | 2-methoxy-N-[3-[[4-(4-phenylphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]acetamide |
|---|---|
| PubChem CID | 73140015 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 2-methoxy-N-[3-[[4-(4-phenylphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]acetamide |
| SMILES | COCC(=O)NC1COC2C(Nc3nccc(-c4ccc(-c5ccccc5)cc4)n3)COC12 |
| InChI | InChI=1S/C25H26N4O4/c1-31-15-22(30)27-20-13-32-24-21(14-33-23(20)24)29-25-26-12-11-19(28-25)18-9-7-17(8-10-18)16-5-3-2-4-6-16/h2-12,20-21,23-24H,13-15H2,1H3,(H,27,30)(H,26,28,29) |
| InChIKey | BXNZQCSENLGWNT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |