C31H33N4O5- — CID 11913312
2-[1-[2-[[(3S,3aR,6S,6aR)-3-[[4-(4-phenylphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]amino]-2-oxoethyl]cyclopentyl]acetate (PubChem CID 11913312) has the molecular formula C31H33N4O5- and a molecular weight of 541.63 g/mol. Its IUPAC name is 2-[1-[2-[[(3S,3aR,6S,6aR)-3-[[4-(4-phenylphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]amino]-2-oxoethyl]cyclopentyl]acetate.
| Compound Name | 2-[1-[2-[[(3S,3aR,6S,6aR)-3-[[4-(4-phenylphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]amino]-2-oxoethyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 11913312 |
| Molecular Formula | C31H33N4O5- |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | 2-[1-[2-[[(3S,3aR,6S,6aR)-3-[[4-(4-phenylphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]amino]-2-oxoethyl]cyclopentyl]acetate |
| SMILES | O=C([O-])CC1(CC(=O)N[C@H]2CO[C@H]3[C@@H]2OC[C@@H]3Nc2nccc(-c3ccc(-c4ccccc4)cc3)n2)CCCC1 |
| InChI | InChI=1S/C31H34N4O5/c36-26(16-31(17-27(37)38)13-4-5-14-31)33-24-18-39-29-25(19-40-28(24)29)35-30-32-15-12-23(34-30)22-10-8-21(9-11-22)20-6-2-1-3-7-20/h1-3,6-12,15,24-25,28-29H,4-5,13-14,16-19H2,(H,33,36)(H,37,38)(H,32,34,35)/p-1/t24-,25-,28+,29+/m0/s1 |
| InChIKey | VAZJFXWTOPUREE-LYWOHPCHSA-M |
| XLogP | 2.96 |
| TPSA | 125.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |