C20H22N4O5S — CID 163070893
2-[2-[[(3R,3aR,6S,6aS)-3-[(4-phenylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]amino]-2-oxoethyl]sulfanylacetic acid (PubChem CID 163070893) has the molecular formula C20H22N4O5S and a molecular weight of 430.49 g/mol. Its IUPAC name is 2-[2-[[(3R,3aR,6S,6aS)-3-[(4-phenylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]amino]-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[[(3R,3aR,6S,6aS)-3-[(4-phenylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]amino]-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 163070893 |
| Molecular Formula | C20H22N4O5S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 2-[2-[[(3R,3aR,6S,6aS)-3-[(4-phenylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]amino]-2-oxoethyl]sulfanylacetic acid |
| SMILES | O=C(O)CSCC(=O)N[C@H]1CO[C@H]2[C@H]1OC[C@H]2Nc1nccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H22N4O5S/c25-16(10-30-11-17(26)27)22-14-8-28-19-15(9-29-18(14)19)24-20-21-7-6-13(23-20)12-4-2-1-3-5-12/h1-7,14-15,18-19H,8-11H2,(H,22,25)(H,26,27)(H,21,23,24)/t14-,15+,18-,19+/m0/s1 |
| InChIKey | QKIZDPXGJJEEBU-QGWWYQLQSA-N |
| XLogP | 1.02 |
| TPSA | 122.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |