C21H21N5O4 — CID 162812929
[(3S,3aS,6S,6aS)-3-[[4-(3-cyanophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-prop-2-enylcarbamate (PubChem CID 162812929) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is [(3S,3aS,6S,6aS)-3-[[4-(3-cyanophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-prop-2-enylcarbamate.
| Compound Name | [(3S,3aS,6S,6aS)-3-[[4-(3-cyanophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 162812929 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | [(3S,3aS,6S,6aS)-3-[[4-(3-cyanophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-prop-2-enylcarbamate |
| SMILES | C=CCNC(=O)O[C@H]1CO[C@@H]2[C@@H]1OC[C@@H]2Nc1nccc(-c2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C21H21N5O4/c1-2-7-24-21(27)30-17-12-29-18-16(11-28-19(17)18)26-20-23-8-6-15(25-20)14-5-3-4-13(9-14)10-22/h2-6,8-9,16-19H,1,7,11-12H2,(H,24,27)(H,23,25,26)/t16-,17-,18-,19+/m0/s1 |
| InChIKey | BMCLHEQUDQUJRN-CADBVGFASA-N |
| XLogP | 1.87 |
| TPSA | 118.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|