C25H21N5O5 — CID 73149113
N-[3-[[4-(3-cyanophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 73149113) has the molecular formula C25H21N5O5 and a molecular weight of 471.47 g/mol. Its IUPAC name is N-[3-[[4-(3-cyanophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[3-[[4-(3-cyanophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 73149113 |
| Molecular Formula | C25H21N5O5 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | N-[3-[[4-(3-cyanophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | N#Cc1cccc(-c2ccnc(NC3COC4C(NC(=O)c5ccc6c(c5)OCO6)COC34)n2)c1 |
| InChI | InChI=1S/C25H21N5O5/c26-10-14-2-1-3-15(8-14)17-6-7-27-25(29-17)30-19-12-33-22-18(11-32-23(19)22)28-24(31)16-4-5-20-21(9-16)35-13-34-20/h1-9,18-19,22-23H,11-13H2,(H,28,31)(H,27,29,30) |
| InChIKey | UKDFHKHNOGMMRR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 127.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |