C26H23N5O6S — CID 73139069
N-[3-[[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]quinoline-8-sulfonamide (PubChem CID 73139069) has the molecular formula C26H23N5O6S and a molecular weight of 533.57 g/mol. Its IUPAC name is N-[3-[[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]quinoline-8-sulfonamide.
| Compound Name | N-[3-[[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 73139069 |
| Molecular Formula | C26H23N5O6S |
| Molecular Weight | 533.57 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | N-[3-[[4-(1,3-benzodioxol-5-yl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]quinoline-8-sulfonamide |
| SMILES | O=S(=O)(NC1COC2C(Nc3nccc(-c4ccc5c(c4)OCO5)n3)COC12)c1cccc2cccnc12 |
| InChI | InChI=1S/C26H23N5O6S/c32-38(33,22-5-1-3-15-4-2-9-27-23(15)22)31-19-13-35-24-18(12-34-25(19)24)30-26-28-10-8-17(29-26)16-6-7-20-21(11-16)37-14-36-20/h1-11,18-19,24-25,31H,12-14H2,(H,28,29,30) |
| InChIKey | MHWJVQAOPZCAAO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.57 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |