C18H22N4O5S — CID 73139560
N-[3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]methanesulfonamide (PubChem CID 73139560) has the molecular formula C18H22N4O5S and a molecular weight of 406.46 g/mol. Its IUPAC name is N-[3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]methanesulfonamide.
| Compound Name | N-[3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 73139560 |
| Molecular Formula | C18H22N4O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N-[3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]methanesulfonamide |
| SMILES | COc1ccc(-c2ccnc(NC3COC4C(NS(C)(=O)=O)COC34)n2)cc1 |
| InChI | InChI=1S/C18H22N4O5S/c1-25-12-5-3-11(4-6-12)13-7-8-19-18(20-13)21-14-9-26-17-15(10-27-16(14)17)22-28(2,23)24/h3-8,14-17,22H,9-10H2,1-2H3,(H,19,20,21) |
| InChIKey | ZOXRHADGZTYJCM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |