C15H18N4O4S2 — CID 73139624
N-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]methanesulfonamide (PubChem CID 73139624) has the molecular formula C15H18N4O4S2 and a molecular weight of 382.47 g/mol. Its IUPAC name is N-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]methanesulfonamide.
| Compound Name | N-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 73139624 |
| Molecular Formula | C15H18N4O4S2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | N-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1COC2C(Nc3nccc(-c4cccs4)n3)COC12 |
| InChI | InChI=1S/C15H18N4O4S2/c1-25(20,21)19-11-8-23-13-10(7-22-14(11)13)18-15-16-5-4-9(17-15)12-3-2-6-24-12/h2-6,10-11,13-14,19H,7-8H2,1H3,(H,16,17,18) |
| InChIKey | GMAXPTWWZWZPEU-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |