C22H23N5O4S — CID 73148989
1-(4-methoxyphenyl)-3-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]urea (PubChem CID 73148989) has the molecular formula C22H23N5O4S and a molecular weight of 453.52 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]urea.
| Compound Name | 1-(4-methoxyphenyl)-3-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]urea |
|---|---|
| PubChem CID | 73148989 |
| Molecular Formula | C22H23N5O4S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]urea |
| SMILES | COc1ccc(NC(=O)NC2COC3C(Nc4nccc(-c5cccs5)n4)COC23)cc1 |
| InChI | InChI=1S/C22H23N5O4S/c1-29-14-6-4-13(5-7-14)24-22(28)27-17-12-31-19-16(11-30-20(17)19)26-21-23-9-8-15(25-21)18-3-2-10-32-18/h2-10,16-17,19-20H,11-12H2,1H3,(H,23,25,26)(H2,24,27,28) |
| InChIKey | WWCSKNCVRRQBTN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 106.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |