C23H25N5O4S2 — CID 73138668
1-(3,5-dimethoxyphenyl)-3-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]thiourea (PubChem CID 73138668) has the molecular formula C23H25N5O4S2 and a molecular weight of 499.62 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]thiourea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]thiourea |
|---|---|
| PubChem CID | 73138668 |
| Molecular Formula | C23H25N5O4S2 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]thiourea |
| SMILES | COc1cc(NC(=S)NC2COC3C(Nc4nccc(-c5cccs5)n4)COC23)cc(OC)c1 |
| InChI | InChI=1S/C23H25N5O4S2/c1-29-14-8-13(9-15(10-14)30-2)25-23(33)28-18-12-32-20-17(11-31-21(18)20)27-22-24-6-5-16(26-22)19-4-3-7-34-19/h3-10,17-18,20-21H,11-12H2,1-2H3,(H,24,26,27)(H2,25,28,33) |
| InChIKey | GRUMOCQBPZBIGX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 98.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|