C22H22N4O4S — CID 73139998
2-phenoxy-N-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]acetamide (PubChem CID 73139998) has the molecular formula C22H22N4O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is 2-phenoxy-N-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]acetamide.
| Compound Name | 2-phenoxy-N-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]acetamide |
|---|---|
| PubChem CID | 73139998 |
| Molecular Formula | C22H22N4O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 2-phenoxy-N-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]acetamide |
| SMILES | O=C(COc1ccccc1)NC1COC2C(Nc3nccc(-c4cccs4)n3)COC12 |
| InChI | InChI=1S/C22H22N4O4S/c27-19(13-28-14-5-2-1-3-6-14)24-16-11-29-21-17(12-30-20(16)21)26-22-23-9-8-15(25-22)18-7-4-10-31-18/h1-10,16-17,20-21H,11-13H2,(H,24,27)(H,23,25,26) |
| InChIKey | ZFZOJGMRUIKAJO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |