C17H21N5O3S — CID 73148441
1-ethyl-3-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]urea (PubChem CID 73148441) has the molecular formula C17H21N5O3S and a molecular weight of 375.45 g/mol. Its IUPAC name is 1-ethyl-3-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]urea.
| Compound Name | 1-ethyl-3-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]urea |
|---|---|
| PubChem CID | 73148441 |
| Molecular Formula | C17H21N5O3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 1-ethyl-3-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]urea |
| SMILES | CCNC(=O)NC1COC2C(Nc3nccc(-c4cccs4)n3)COC12 |
| InChI | InChI=1S/C17H21N5O3S/c1-2-18-17(23)22-12-9-25-14-11(8-24-15(12)14)21-16-19-6-5-10(20-16)13-4-3-7-26-13/h3-7,11-12,14-15H,2,8-9H2,1H3,(H2,18,22,23)(H,19,20,21) |
| InChIKey | SGGSIECAPXYWAZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |