C22H20F3N5O3S — CID 73148446
1-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 73148446) has the molecular formula C22H20F3N5O3S and a molecular weight of 491.50 g/mol. Its IUPAC name is 1-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 73148446 |
| Molecular Formula | C22H20F3N5O3S |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 1-[3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)NC1COC2C(Nc3nccc(-c4cccs4)n3)COC12 |
| InChI | InChI=1S/C22H20F3N5O3S/c23-22(24,25)12-3-1-4-13(9-12)27-21(31)30-16-11-33-18-15(10-32-19(16)18)29-20-26-7-6-14(28-20)17-5-2-8-34-17/h1-9,15-16,18-19H,10-11H2,(H,26,28,29)(H2,27,30,31) |
| InChIKey | ZWAIQBCJCBVWJS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |