C21H19F3N6O3 — CID 162802424
1-[(3S,3aS,6R,6aR)-6-(4-pyridin-2-yltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 162802424) has the molecular formula C21H19F3N6O3 and a molecular weight of 460.42 g/mol. Its IUPAC name is 1-[(3S,3aS,6R,6aR)-6-(4-pyridin-2-yltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(3S,3aS,6R,6aR)-6-(4-pyridin-2-yltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 162802424 |
| Molecular Formula | C21H19F3N6O3 |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 1-[(3S,3aS,6R,6aR)-6-(4-pyridin-2-yltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)N[C@H]1CO[C@H]2[C@H]1OC[C@H]2n1cc(-c2ccccn2)nn1 |
| InChI | InChI=1S/C21H19F3N6O3/c22-21(23,24)12-4-3-5-13(8-12)26-20(31)27-16-10-32-19-17(11-33-18(16)19)30-9-15(28-29-30)14-6-1-2-7-25-14/h1-9,16-19H,10-11H2,(H2,26,27,31)/t16-,17+,18-,19+/m0/s1 |
| InChIKey | JCAHALAHYCRKQV-ZSYWTGECSA-N |
| XLogP | 2.89 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |