C19H20N6O2 — CID 40533386
(3S,3aR,6S,6aR)-N-(pyridin-2-ylmethyl)-6-(4-pyridin-2-yltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine (PubChem CID 40533386) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is (3S,3aR,6S,6aR)-N-(pyridin-2-ylmethyl)-6-(4-pyridin-2-yltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine.
| Compound Name | (3S,3aR,6S,6aR)-N-(pyridin-2-ylmethyl)-6-(4-pyridin-2-yltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine |
|---|---|
| PubChem CID | 40533386 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (3S,3aR,6S,6aR)-N-(pyridin-2-ylmethyl)-6-(4-pyridin-2-yltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-amine |
| SMILES | c1ccc(CN[C@H]2CO[C@H]3[C@@H]2OC[C@@H]3n2cc(-c3ccccn3)nn2)nc1 |
| InChI | InChI=1S/C19H20N6O2/c1-3-7-20-13(5-1)9-22-16-11-26-19-17(12-27-18(16)19)25-10-15(23-24-25)14-6-2-4-8-21-14/h1-8,10,16-19,22H,9,11-12H2/t16-,17-,18+,19+/m0/s1 |
| InChIKey | VGIBODKKSKECBG-INDMIFKZSA-N |
| XLogP | 1.23 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |