C16H19N5O4 — CID 162843746
methyl 1-[(3S,3aS,6R,6aR)-3-(pyridin-2-ylmethylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazole-4-carboxylate (PubChem CID 162843746) has the molecular formula C16H19N5O4 and a molecular weight of 345.36 g/mol. Its IUPAC name is methyl 1-[(3S,3aS,6R,6aR)-3-(pyridin-2-ylmethylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazole-4-carboxylate.
| Compound Name | methyl 1-[(3S,3aS,6R,6aR)-3-(pyridin-2-ylmethylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 162843746 |
| Molecular Formula | C16H19N5O4 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | methyl 1-[(3S,3aS,6R,6aR)-3-(pyridin-2-ylmethylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn([C@@H]2CO[C@@H]3[C@@H]2OC[C@@H]3NCc2ccccn2)nn1 |
| InChI | InChI=1S/C16H19N5O4/c1-23-16(22)11-7-21(20-19-11)13-9-25-14-12(8-24-15(13)14)18-6-10-4-2-3-5-17-10/h2-5,7,12-15,18H,6,8-9H2,1H3/t12-,13+,14-,15+/m0/s1 |
| InChIKey | ZPFQKBSANVPUDT-LJISPDSOSA-N |
| XLogP | -0.04 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |