C18H20N4O6 — CID 73134944
methyl 1-[3-[(2-phenoxyacetyl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazole-4-carboxylate (PubChem CID 73134944) has the molecular formula C18H20N4O6 and a molecular weight of 388.38 g/mol. Its IUPAC name is methyl 1-[3-[(2-phenoxyacetyl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazole-4-carboxylate.
| Compound Name | methyl 1-[3-[(2-phenoxyacetyl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 73134944 |
| Molecular Formula | C18H20N4O6 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | methyl 1-[3-[(2-phenoxyacetyl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(C2COC3C(NC(=O)COc4ccccc4)COC32)nn1 |
| InChI | InChI=1S/C18H20N4O6/c1-25-18(24)12-7-22(21-20-12)14-9-28-16-13(8-27-17(14)16)19-15(23)10-26-11-5-3-2-4-6-11/h2-7,13-14,16-17H,8-10H2,1H3,(H,19,23) |
| InChIKey | OGVVKGUAIYAINU-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |