C18H21N5O7S — CID 163161208
methyl 1-[(3R,3aR,6S,6aS)-3-[(4-acetamidophenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazole-4-carboxylate (PubChem CID 163161208) has the molecular formula C18H21N5O7S and a molecular weight of 451.46 g/mol. Its IUPAC name is methyl 1-[(3R,3aR,6S,6aS)-3-[(4-acetamidophenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazole-4-carboxylate.
| Compound Name | methyl 1-[(3R,3aR,6S,6aS)-3-[(4-acetamidophenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 163161208 |
| Molecular Formula | C18H21N5O7S |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | methyl 1-[(3R,3aR,6S,6aS)-3-[(4-acetamidophenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn([C@H]2CO[C@H]3[C@H]2OC[C@H]3NS(=O)(=O)c2ccc(NC(C)=O)cc2)nn1 |
| InChI | InChI=1S/C18H21N5O7S/c1-10(24)19-11-3-5-12(6-4-11)31(26,27)21-14-8-29-17-15(9-30-16(14)17)23-7-13(20-22-23)18(25)28-2/h3-7,14-17,21H,8-9H2,1-2H3,(H,19,24)/t14-,15+,16-,17+/m1/s1 |
| InChIKey | RBOVSXJDQGDIAU-TWMKSMIVSA-N |
| XLogP | -0.29 |
| TPSA | 150.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |