C13H18N2O6S — CID 67615689
N-[4-[[(5R,6S)-6-hydroxy-1,3-dioxepan-5-yl]sulfamoyl]phenyl]acetamide (PubChem CID 67615689) has the molecular formula C13H18N2O6S and a molecular weight of 330.36 g/mol. Its IUPAC name is N-[4-[[(5R,6S)-6-hydroxy-1,3-dioxepan-5-yl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[(5R,6S)-6-hydroxy-1,3-dioxepan-5-yl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 67615689 |
| Molecular Formula | C13H18N2O6S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | N-[4-[[(5R,6S)-6-hydroxy-1,3-dioxepan-5-yl]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N[C@@H]2COCOC[C@H]2O)cc1 |
| InChI | InChI=1S/C13H18N2O6S/c1-9(16)14-10-2-4-11(5-3-10)22(18,19)15-12-6-20-8-21-7-13(12)17/h2-5,12-13,15,17H,6-8H2,1H3,(H,14,16)/t12-,13-/m1/s1 |
| InChIKey | WERWVEUXZQOGMO-CHWSQXEVSA-N |
| XLogP | -0.34 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |