C22H25N3O8S — CID 73133210
[3-[(4-acetamidophenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-methoxyphenyl)carbamate (PubChem CID 73133210) has the molecular formula C22H25N3O8S and a molecular weight of 491.52 g/mol. Its IUPAC name is [3-[(4-acetamidophenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-methoxyphenyl)carbamate.
| Compound Name | [3-[(4-acetamidophenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 73133210 |
| Molecular Formula | C22H25N3O8S |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | [3-[(4-acetamidophenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-methoxyphenyl)carbamate |
| SMILES | COc1ccc(NC(=O)OC2COC3C(NS(=O)(=O)c4ccc(NC(C)=O)cc4)COC23)cc1 |
| InChI | InChI=1S/C22H25N3O8S/c1-13(26)23-14-5-9-17(10-6-14)34(28,29)25-18-11-31-21-19(12-32-20(18)21)33-22(27)24-15-3-7-16(30-2)8-4-15/h3-10,18-21,25H,11-12H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | HLXBHNKVGPQODP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |