C21H22N2O6 — CID 73133190
(3-benzamido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) N-(4-methoxyphenyl)carbamate (PubChem CID 73133190) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is (3-benzamido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) N-(4-methoxyphenyl)carbamate.
| Compound Name | (3-benzamido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) N-(4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 73133190 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (3-benzamido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) N-(4-methoxyphenyl)carbamate |
| SMILES | COc1ccc(NC(=O)OC2COC3C(NC(=O)c4ccccc4)COC23)cc1 |
| InChI | InChI=1S/C21H22N2O6/c1-26-15-9-7-14(8-10-15)22-21(25)29-17-12-28-18-16(11-27-19(17)18)23-20(24)13-5-3-2-4-6-13/h2-10,16-19H,11-12H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | KRXJMBITQJYWNP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |