C21H20N2O7 — CID 162859497
[(3S,3aS,6S,6aS)-3-(1,3-benzodioxole-5-carbonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-phenylcarbamate (PubChem CID 162859497) has the molecular formula C21H20N2O7 and a molecular weight of 412.40 g/mol. Its IUPAC name is [(3S,3aS,6S,6aS)-3-(1,3-benzodioxole-5-carbonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-phenylcarbamate.
| Compound Name | [(3S,3aS,6S,6aS)-3-(1,3-benzodioxole-5-carbonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 162859497 |
| Molecular Formula | C21H20N2O7 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | [(3S,3aS,6S,6aS)-3-(1,3-benzodioxole-5-carbonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)O[C@H]1CO[C@@H]2[C@@H]1OC[C@@H]2NC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H20N2O7/c24-20(12-6-7-15-16(8-12)29-11-28-15)23-14-9-26-19-17(10-27-18(14)19)30-21(25)22-13-4-2-1-3-5-13/h1-8,14,17-19H,9-11H2,(H,22,25)(H,23,24)/t14-,17-,18-,19+/m0/s1 |
| InChIKey | KSEIFIVCODESOG-UDTPNQRGSA-N |
| XLogP | 1.93 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |