C16H21N3O5 — CID 162850772
[(3S,3aS,6S,6aS)-3-(phenylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-ethylcarbamate (PubChem CID 162850772) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is [(3S,3aS,6S,6aS)-3-(phenylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-ethylcarbamate.
| Compound Name | [(3S,3aS,6S,6aS)-3-(phenylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-ethylcarbamate |
|---|---|
| PubChem CID | 162850772 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | [(3S,3aS,6S,6aS)-3-(phenylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-ethylcarbamate |
| SMILES | CCNC(=O)O[C@H]1CO[C@@H]2[C@@H]1OC[C@@H]2NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H21N3O5/c1-2-17-16(21)24-12-9-23-13-11(8-22-14(12)13)19-15(20)18-10-6-4-3-5-7-10/h3-7,11-14H,2,8-9H2,1H3,(H,17,21)(H2,18,19,20)/t11-,12-,13-,14+/m0/s1 |
| InChIKey | BQZDTRKMIRNXJT-XDQVBPFNSA-N |
| XLogP | 1.09 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |