C19H27N3O5 — CID 73133262
[3-[(4-propan-2-ylphenyl)carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-ethylcarbamate (PubChem CID 73133262) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is [3-[(4-propan-2-ylphenyl)carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-ethylcarbamate.
| Compound Name | [3-[(4-propan-2-ylphenyl)carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-ethylcarbamate |
|---|---|
| PubChem CID | 73133262 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | [3-[(4-propan-2-ylphenyl)carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-ethylcarbamate |
| SMILES | CCNC(=O)OC1COC2C(NC(=O)Nc3ccc(C(C)C)cc3)COC12 |
| InChI | InChI=1S/C19H27N3O5/c1-4-20-19(24)27-15-10-26-16-14(9-25-17(15)16)22-18(23)21-13-7-5-12(6-8-13)11(2)3/h5-8,11,14-17H,4,9-10H2,1-3H3,(H,20,24)(H2,21,22,23) |
| InChIKey | MFKPDPKOGWIUTI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |