C23H26ClN3O4S — CID 162804182
[(3S,3aS,6S,6aS)-3-[(4-chlorophenyl)carbamothioylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-propan-2-ylphenyl)carbamate (PubChem CID 162804182) has the molecular formula C23H26ClN3O4S and a molecular weight of 476.00 g/mol. Its IUPAC name is [(3S,3aS,6S,6aS)-3-[(4-chlorophenyl)carbamothioylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-propan-2-ylphenyl)carbamate.
| Compound Name | [(3S,3aS,6S,6aS)-3-[(4-chlorophenyl)carbamothioylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-propan-2-ylphenyl)carbamate |
|---|---|
| PubChem CID | 162804182 |
| Molecular Formula | C23H26ClN3O4S |
| Molecular Weight | 476.00 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | [(3S,3aS,6S,6aS)-3-[(4-chlorophenyl)carbamothioylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-propan-2-ylphenyl)carbamate |
| SMILES | CC(C)c1ccc(NC(=O)O[C@H]2CO[C@@H]3[C@@H]2OC[C@@H]3NC(=S)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H26ClN3O4S/c1-13(2)14-3-7-17(8-4-14)26-23(28)31-19-12-30-20-18(11-29-21(19)20)27-22(32)25-16-9-5-15(24)6-10-16/h3-10,13,18-21H,11-12H2,1-2H3,(H,26,28)(H2,25,27,32)/t18-,19-,20-,21+/m0/s1 |
| InChIKey | PSCDQSUOXGPECM-XSDIEEQYSA-N |
| XLogP | 4.53 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.00 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|