C17H24N2O4 — CID 73132959
1-(6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl)-3-(4-propan-2-ylphenyl)urea (PubChem CID 73132959) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-(6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl)-3-(4-propan-2-ylphenyl)urea.
| Compound Name | 1-(6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl)-3-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 73132959 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 1-(6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl)-3-(4-propan-2-ylphenyl)urea |
| SMILES | COC1COC2C(NC(=O)Nc3ccc(C(C)C)cc3)COC12 |
| InChI | InChI=1S/C17H24N2O4/c1-10(2)11-4-6-12(7-5-11)18-17(20)19-13-8-22-16-14(21-3)9-23-15(13)16/h4-7,10,13-16H,8-9H2,1-3H3,(H2,18,19,20) |
| InChIKey | CECCXTMBNNHANG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |