C22H24N2O7 — CID 11883255
methyl 2-[[(3S,3aR,6R,6aS)-3-[(4-phenoxyphenyl)carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate (PubChem CID 11883255) has the molecular formula C22H24N2O7 and a molecular weight of 428.44 g/mol. Its IUPAC name is methyl 2-[[(3S,3aR,6R,6aS)-3-[(4-phenoxyphenyl)carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate.
| Compound Name | methyl 2-[[(3S,3aR,6R,6aS)-3-[(4-phenoxyphenyl)carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 11883255 |
| Molecular Formula | C22H24N2O7 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | methyl 2-[[(3S,3aR,6R,6aS)-3-[(4-phenoxyphenyl)carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate |
| SMILES | COC(=O)CO[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2NC(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C22H24N2O7/c1-27-19(25)13-28-18-12-30-20-17(11-29-21(18)20)24-22(26)23-14-7-9-16(10-8-14)31-15-5-3-2-4-6-15/h2-10,17-18,20-21H,11-13H2,1H3,(H2,23,24,26)/t17-,18+,20+,21+/m0/s1 |
| InChIKey | GFPOQFJDEZTACD-UYWIDEMCSA-N |
| XLogP | 2.32 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |