C24H23N3O5 — CID 163117820
[(3R,3aR,6R,6aR)-3-(phenylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-naphthalen-1-ylcarbamate (PubChem CID 163117820) has the molecular formula C24H23N3O5 and a molecular weight of 433.46 g/mol. Its IUPAC name is [(3R,3aR,6R,6aR)-3-(phenylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-naphthalen-1-ylcarbamate.
| Compound Name | [(3R,3aR,6R,6aR)-3-(phenylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-naphthalen-1-ylcarbamate |
|---|---|
| PubChem CID | 163117820 |
| Molecular Formula | C24H23N3O5 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | [(3R,3aR,6R,6aR)-3-(phenylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-naphthalen-1-ylcarbamate |
| SMILES | O=C(Nc1ccccc1)N[C@@H]1CO[C@@H]2[C@@H]1OC[C@H]2OC(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C24H23N3O5/c28-23(25-16-9-2-1-3-10-16)26-19-13-30-22-20(14-31-21(19)22)32-24(29)27-18-12-6-8-15-7-4-5-11-17(15)18/h1-12,19-22H,13-14H2,(H,27,29)(H2,25,26,28)/t19-,20-,21-,22+/m1/s1 |
| InChIKey | ALKNKRYWPZOCDK-YSFYHYPLSA-N |
| XLogP | 3.74 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |