C30H28N2O4 — CID 73133620
[3-[(4-phenylphenyl)methylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-naphthalen-1-ylcarbamate (PubChem CID 73133620) has the molecular formula C30H28N2O4 and a molecular weight of 480.56 g/mol. Its IUPAC name is [3-[(4-phenylphenyl)methylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-naphthalen-1-ylcarbamate.
| Compound Name | [3-[(4-phenylphenyl)methylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-naphthalen-1-ylcarbamate |
|---|---|
| PubChem CID | 73133620 |
| Molecular Formula | C30H28N2O4 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | [3-[(4-phenylphenyl)methylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-naphthalen-1-ylcarbamate |
| SMILES | O=C(Nc1cccc2ccccc12)OC1COC2C(NCc3ccc(-c4ccccc4)cc3)COC12 |
| InChI | InChI=1S/C30H28N2O4/c33-30(32-25-12-6-10-23-9-4-5-11-24(23)25)36-27-19-35-28-26(18-34-29(27)28)31-17-20-13-15-22(16-14-20)21-7-2-1-3-8-21/h1-16,26-29,31H,17-19H2,(H,32,33) |
| InChIKey | TZXXUWAARXDRBE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |