C24H21N3O6S — CID 163085776
[(3S,3aS,6S,6aS)-3-[(2-cyanophenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-naphthalen-1-ylcarbamate (PubChem CID 163085776) has the molecular formula C24H21N3O6S and a molecular weight of 479.51 g/mol. Its IUPAC name is [(3S,3aS,6S,6aS)-3-[(2-cyanophenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-naphthalen-1-ylcarbamate.
| Compound Name | [(3S,3aS,6S,6aS)-3-[(2-cyanophenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-naphthalen-1-ylcarbamate |
|---|---|
| PubChem CID | 163085776 |
| Molecular Formula | C24H21N3O6S |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | [(3S,3aS,6S,6aS)-3-[(2-cyanophenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-naphthalen-1-ylcarbamate |
| SMILES | N#Cc1ccccc1S(=O)(=O)N[C@H]1CO[C@H]2[C@H]1OC[C@@H]2OC(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C24H21N3O6S/c25-12-16-7-2-4-11-21(16)34(29,30)27-19-13-31-23-20(14-32-22(19)23)33-24(28)26-18-10-5-8-15-6-1-3-9-17(15)18/h1-11,19-20,22-23,27H,13-14H2,(H,26,28)/t19-,20-,22-,23+/m0/s1 |
| InChIKey | JXKNLJUNIGABCO-BAMDZGJYSA-N |
| XLogP | 2.77 |
| TPSA | 126.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |