C22H27N3O6S — CID 11883362
[(3S,3aR,6R,6aS)-3-(quinolin-8-ylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-cyclohexylcarbamate (PubChem CID 11883362) has the molecular formula C22H27N3O6S and a molecular weight of 461.54 g/mol. Its IUPAC name is [(3S,3aR,6R,6aS)-3-(quinolin-8-ylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-cyclohexylcarbamate.
| Compound Name | [(3S,3aR,6R,6aS)-3-(quinolin-8-ylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 11883362 |
| Molecular Formula | C22H27N3O6S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | [(3S,3aR,6R,6aS)-3-(quinolin-8-ylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-cyclohexylcarbamate |
| SMILES | O=C(NC1CCCCC1)O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2NS(=O)(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C22H27N3O6S/c26-22(24-15-8-2-1-3-9-15)31-17-13-30-20-16(12-29-21(17)20)25-32(27,28)18-10-4-6-14-7-5-11-23-19(14)18/h4-7,10-11,15-17,20-21,25H,1-3,8-9,12-13H2,(H,24,26)/t16-,17+,20+,21+/m0/s1 |
| InChIKey | QXEUEZRVPOVHKW-XWDORNJCSA-N |
| XLogP | 2.11 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |