C25H22FN5O4S — CID 73140061
N-[3-[[4-(3-fluorophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]quinoline-8-sulfonamide (PubChem CID 73140061) has the molecular formula C25H22FN5O4S and a molecular weight of 507.55 g/mol. Its IUPAC name is N-[3-[[4-(3-fluorophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]quinoline-8-sulfonamide.
| Compound Name | N-[3-[[4-(3-fluorophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 73140061 |
| Molecular Formula | C25H22FN5O4S |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | N-[3-[[4-(3-fluorophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]quinoline-8-sulfonamide |
| SMILES | O=S(=O)(NC1COC2C(Nc3nccc(-c4cccc(F)c4)n3)COC12)c1cccc2cccnc12 |
| InChI | InChI=1S/C25H22FN5O4S/c26-17-7-1-5-16(12-17)18-9-11-28-25(29-18)30-19-13-34-24-20(14-35-23(19)24)31-36(32,33)21-8-2-4-15-6-3-10-27-22(15)21/h1-12,19-20,23-24,31H,13-14H2,(H,28,29,30) |
| InChIKey | XOOHYZNUVXMELK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |