C20H19FN4O4S2 — CID 163124064
N-[(3R,3aR,6S,6aS)-3-[[4-(3-fluorophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]thiophene-2-sulfonamide (PubChem CID 163124064) has the molecular formula C20H19FN4O4S2 and a molecular weight of 462.53 g/mol. Its IUPAC name is N-[(3R,3aR,6S,6aS)-3-[[4-(3-fluorophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]thiophene-2-sulfonamide.
| Compound Name | N-[(3R,3aR,6S,6aS)-3-[[4-(3-fluorophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 163124064 |
| Molecular Formula | C20H19FN4O4S2 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | N-[(3R,3aR,6S,6aS)-3-[[4-(3-fluorophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(N[C@H]1CO[C@H]2[C@H]1OC[C@H]2Nc1nccc(-c2cccc(F)c2)n1)c1cccs1 |
| InChI | InChI=1S/C20H19FN4O4S2/c21-13-4-1-3-12(9-13)14-6-7-22-20(23-14)24-15-10-28-19-16(11-29-18(15)19)25-31(26,27)17-5-2-8-30-17/h1-9,15-16,18-19,25H,10-11H2,(H,22,23,24)/t15-,16+,18-,19+/m1/s1 |
| InChIKey | CPBHSHXZTXJWSI-JFRXWTBNSA-N |
| XLogP | 2.27 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |