C25H23N3O4 — CID 163150166
[(3S,3aS,6S,6aS)-3-[(3-cyanophenyl)methylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-naphthalen-1-ylcarbamate (PubChem CID 163150166) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is [(3S,3aS,6S,6aS)-3-[(3-cyanophenyl)methylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-naphthalen-1-ylcarbamate.
| Compound Name | [(3S,3aS,6S,6aS)-3-[(3-cyanophenyl)methylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-naphthalen-1-ylcarbamate |
|---|---|
| PubChem CID | 163150166 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | [(3S,3aS,6S,6aS)-3-[(3-cyanophenyl)methylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-naphthalen-1-ylcarbamate |
| SMILES | N#Cc1cccc(CN[C@H]2CO[C@H]3[C@H]2OC[C@@H]3OC(=O)Nc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C25H23N3O4/c26-12-16-5-3-6-17(11-16)13-27-21-14-30-24-22(15-31-23(21)24)32-25(29)28-20-10-4-8-18-7-1-2-9-19(18)20/h1-11,21-24,27H,13-15H2,(H,28,29)/t21-,22-,23-,24+/m0/s1 |
| InChIKey | NAYVXZSWZRBDIZ-NEWJYFPISA-N |
| XLogP | 3.58 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |