C27H25F3N2O4 — CID 11884582
[(3S,3aR,6R,6aS)-3-[(4-phenylphenyl)methylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-[3-(trifluoromethyl)phenyl]carbamate (PubChem CID 11884582) has the molecular formula C27H25F3N2O4 and a molecular weight of 498.50 g/mol. Its IUPAC name is [(3S,3aR,6R,6aS)-3-[(4-phenylphenyl)methylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-[3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | [(3S,3aR,6R,6aS)-3-[(4-phenylphenyl)methylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-[3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 11884582 |
| Molecular Formula | C27H25F3N2O4 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | [(3S,3aR,6R,6aS)-3-[(4-phenylphenyl)methylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-[3-(trifluoromethyl)phenyl]carbamate |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2NCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H25F3N2O4/c28-27(29,30)20-7-4-8-21(13-20)32-26(33)36-23-16-35-24-22(15-34-25(23)24)31-14-17-9-11-19(12-10-17)18-5-2-1-3-6-18/h1-13,22-25,31H,14-16H2,(H,32,33)/t22-,23+,24+,25+/m0/s1 |
| InChIKey | JVHNQFLIVPOPRA-ZYQDXHPFSA-N |
| XLogP | 5.25 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |