C21H18F3N5O4 — CID 162838605
[(3R,3aR,6R,6aR)-3-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-[3-(trifluoromethyl)phenyl]carbamate (PubChem CID 162838605) has the molecular formula C21H18F3N5O4 and a molecular weight of 461.40 g/mol. Its IUPAC name is [(3R,3aR,6R,6aR)-3-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-[3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | [(3R,3aR,6R,6aR)-3-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-[3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 162838605 |
| Molecular Formula | C21H18F3N5O4 |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | [(3R,3aR,6R,6aR)-3-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-[3-(trifluoromethyl)phenyl]carbamate |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)O[C@@H]1CO[C@H]2[C@H]1OC[C@H]2n1nnnc1-c1ccccc1 |
| InChI | InChI=1S/C21H18F3N5O4/c22-21(23,24)13-7-4-8-14(9-13)25-20(30)33-16-11-32-17-15(10-31-18(16)17)29-19(26-27-28-29)12-5-2-1-3-6-12/h1-9,15-18H,10-11H2,(H,25,30)/t15-,16-,17-,18+/m1/s1 |
| InChIKey | LGOVLTYUYXWSNW-TVFCKZIOSA-N |
| XLogP | 3.31 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |