C20H19N5O4 — CID 163169989
[(3R,3aR,6R,6aR)-3-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-phenylcarbamate (PubChem CID 163169989) has the molecular formula C20H19N5O4 and a molecular weight of 393.40 g/mol. Its IUPAC name is [(3R,3aR,6R,6aR)-3-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-phenylcarbamate.
| Compound Name | [(3R,3aR,6R,6aR)-3-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 163169989 |
| Molecular Formula | C20H19N5O4 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [(3R,3aR,6R,6aR)-3-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)O[C@@H]1CO[C@H]2[C@H]1OC[C@H]2n1nnnc1-c1ccccc1 |
| InChI | InChI=1S/C20H19N5O4/c26-20(21-14-9-5-2-6-10-14)29-16-12-28-17-15(11-27-18(16)17)25-19(22-23-24-25)13-7-3-1-4-8-13/h1-10,15-18H,11-12H2,(H,21,26)/t15-,16-,17-,18+/m1/s1 |
| InChIKey | UYQGLCKCMQQNQH-TVFCKZIOSA-N |
| XLogP | 2.30 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |