C19H21N5O5 — CID 73134361
[3-(5-prop-2-enyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-acetylphenyl)carbamate (PubChem CID 73134361) has the molecular formula C19H21N5O5 and a molecular weight of 399.41 g/mol. Its IUPAC name is [3-(5-prop-2-enyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-acetylphenyl)carbamate.
| Compound Name | [3-(5-prop-2-enyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-acetylphenyl)carbamate |
|---|---|
| PubChem CID | 73134361 |
| Molecular Formula | C19H21N5O5 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | [3-(5-prop-2-enyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-acetylphenyl)carbamate |
| SMILES | C=CCc1nnnn1C1COC2C(OC(=O)Nc3ccc(C(C)=O)cc3)COC21 |
| InChI | InChI=1S/C19H21N5O5/c1-3-4-16-21-22-23-24(16)14-9-27-18-15(10-28-17(14)18)29-19(26)20-13-7-5-12(6-8-13)11(2)25/h3,5-8,14-15,17-18H,1,4,9-10H2,2H3,(H,20,26) |
| InChIKey | SKJNHMOGFAXDLS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|