C26H23N5O4 — CID 11886067
[(3S,3aR,6R,6aS)-3-[5-(4-phenylphenyl)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-phenylcarbamate (PubChem CID 11886067) has the molecular formula C26H23N5O4 and a molecular weight of 469.50 g/mol. Its IUPAC name is [(3S,3aR,6R,6aS)-3-[5-(4-phenylphenyl)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-phenylcarbamate.
| Compound Name | [(3S,3aR,6R,6aS)-3-[5-(4-phenylphenyl)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 11886067 |
| Molecular Formula | C26H23N5O4 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | [(3S,3aR,6R,6aS)-3-[5-(4-phenylphenyl)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2n1nnnc1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H23N5O4/c32-26(27-20-9-5-2-6-10-20)35-22-16-34-23-21(15-33-24(22)23)31-25(28-29-30-31)19-13-11-18(12-14-19)17-7-3-1-4-8-17/h1-14,21-24H,15-16H2,(H,27,32)/t21-,22+,23+,24+/m0/s1 |
| InChIKey | MIFPFSUVYGTCDA-OLKYXYMISA-N |
| XLogP | 3.96 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |