C23H26N6O4 — CID 162809089
[(3R,3aR,6R,6aR)-3-[5-[4-(dimethylamino)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-benzylcarbamate (PubChem CID 162809089) has the molecular formula C23H26N6O4 and a molecular weight of 450.50 g/mol. Its IUPAC name is [(3R,3aR,6R,6aR)-3-[5-[4-(dimethylamino)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-benzylcarbamate.
| Compound Name | [(3R,3aR,6R,6aR)-3-[5-[4-(dimethylamino)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-benzylcarbamate |
|---|---|
| PubChem CID | 162809089 |
| Molecular Formula | C23H26N6O4 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | [(3R,3aR,6R,6aR)-3-[5-[4-(dimethylamino)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-benzylcarbamate |
| SMILES | CN(C)c1ccc(-c2nnnn2[C@@H]2CO[C@@H]3[C@@H]2OC[C@H]3OC(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H26N6O4/c1-28(2)17-10-8-16(9-11-17)22-25-26-27-29(22)18-13-31-21-19(14-32-20(18)21)33-23(30)24-12-15-6-4-3-5-7-15/h3-11,18-21H,12-14H2,1-2H3,(H,24,30)/t18-,19-,20-,21+/m1/s1 |
| InChIKey | RFIWHBIINIMWGF-NCYKPQTJSA-N |
| XLogP | 2.04 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |